About 2-aminoacetic acid;prop-2-enamide
2-aminoacetic acid;prop-2-enamide (PubChem CID 87241070) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is 2-aminoacetic acid;prop-2-enamide.
Molecular Properties
| Compound Name | 2-aminoacetic acid;prop-2-enamide |
| PubChem CID | 87241070 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 2-aminoacetic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.NCC(=O)O |
| InChI | InChI=1S/C3H5NO.C2H5NO2/c1-2-3(4)5;3-1-2(4)5/h2H,1H2,(H2,4,5);1,3H2,(H,4,5) |
| InChIKey | BZLRBRVEFLUUJT-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;prop-2-enamide?
The IUPAC name of 2-aminoacetic acid;prop-2-enamide (CID 87241070) is 2-aminoacetic acid;prop-2-enamide.
What is the SMILES notation for 2-aminoacetic acid;prop-2-enamide?
The canonical SMILES for 2-aminoacetic acid;prop-2-enamide is C=CC(N)=O.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;prop-2-enamide?
The InChIKey is BZLRBRVEFLUUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO.C2H5NO2/c1-2-3(4)5;3-1-2(4)5/h2H,1H2,(H2,4,5);1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;prop-2-enamide?
2-aminoacetic acid;prop-2-enamide has a molecular weight of 146.15 g/mol, XLogP of -1.31, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;prop-2-enamide is sourced from PubChem (CID 87241070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).