About 2-aminoethanol;prop-2-enamide
2-aminoethanol;prop-2-enamide (PubChem CID 160789080) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-aminoethanol;prop-2-enamide.
Molecular Properties
| Compound Name | 2-aminoethanol;prop-2-enamide |
| PubChem CID | 160789080 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 2-aminoethanol;prop-2-enamide |
| SMILES | C=CC(N)=O.NCCO |
| InChI | InChI=1S/C3H5NO.C2H7NO/c1-2-3(4)5;3-1-2-4/h2H,1H2,(H2,4,5);4H,1-3H2 |
| InChIKey | SBPIHJFNXYZBIE-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;prop-2-enamide?
The IUPAC name of 2-aminoethanol;prop-2-enamide (CID 160789080) is 2-aminoethanol;prop-2-enamide.
What is the SMILES notation for 2-aminoethanol;prop-2-enamide?
The canonical SMILES for 2-aminoethanol;prop-2-enamide is C=CC(N)=O.NCCO.
What is the InChIKey of 2-aminoethanol;prop-2-enamide?
The InChIKey is SBPIHJFNXYZBIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO.C2H7NO/c1-2-3(4)5;3-1-2-4/h2H,1H2,(H2,4,5);4H,1-3H2.
What are the key properties of 2-aminoethanol;prop-2-enamide?
2-aminoethanol;prop-2-enamide has a molecular weight of 132.16 g/mol, XLogP of -1.40, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;prop-2-enamide is sourced from PubChem (CID 160789080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).