2-aminoethanol;prop-2-enoic acid

C5H11NO3 — CID 19812730

IUPAC2-aminoethanol;prop-2-enoic acid
SMILESC=CC(=O)O.NCCO
InChIInChI=1S/C3H4O2.C2H7NO/c1-2-3(4)5;3-1-2-4/h2H,1H2,(H,4,5);4H,1-3H2
InChIKeyLCLMOJQKUBRPIM-UHFFFAOYSA-N
MW133.15 g/mol
LogP-0.81
Rot. Bonds2

About 2-aminoethanol;prop-2-enoic acid

2-aminoethanol;prop-2-enoic acid (PubChem CID 19812730) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-aminoethanol;prop-2-enoic acid.

Molecular Properties

Compound Name2-aminoethanol;prop-2-enoic acid
PubChem CID19812730
Molecular FormulaC5H11NO3
Molecular Weight133.15 g/mol
Exact Mass133.07
IUPAC Name2-aminoethanol;prop-2-enoic acid
SMILESC=CC(=O)O.NCCO
InChIInChI=1S/C3H4O2.C2H7NO/c1-2-3(4)5;3-1-2-4/h2H,1H2,(H,4,5);4H,1-3H2
InChIKeyLCLMOJQKUBRPIM-UHFFFAOYSA-N
XLogP-0.81
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500133.15
LogP ≤ 5-0.81
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-aminoethanol;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoethanol;prop-2-enoic acid?
The IUPAC name of 2-aminoethanol;prop-2-enoic acid (CID 19812730) is 2-aminoethanol;prop-2-enoic acid.
What is the SMILES notation for 2-aminoethanol;prop-2-enoic acid?
The canonical SMILES for 2-aminoethanol;prop-2-enoic acid is C=CC(=O)O.NCCO.
What is the InChIKey of 2-aminoethanol;prop-2-enoic acid?
The InChIKey is LCLMOJQKUBRPIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.C2H7NO/c1-2-3(4)5;3-1-2-4/h2H,1H2,(H,4,5);4H,1-3H2.
What are the key properties of 2-aminoethanol;prop-2-enoic acid?
2-aminoethanol;prop-2-enoic acid has a molecular weight of 133.15 g/mol, XLogP of -0.81, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;prop-2-enoic acid is sourced from PubChem (CID 19812730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).