About ethanol;prop-2-enoic acid
ethanol;prop-2-enoic acid (PubChem CID 159350313) has the molecular formula C13H34O7
and a molecular weight of 302.41 g/mol. Its IUPAC name is ethanol;prop-2-enoic acid.
Molecular Properties
| Compound Name | ethanol;prop-2-enoic acid |
| PubChem CID | 159350313 |
| Molecular Formula | C13H34O7 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | ethanol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCO.CCO.CCO.CCO.CCO |
| InChI | InChI=1S/C3H4O2.5C2H6O/c1-2-3(4)5;5*1-2-3/h2H,1H2,(H,4,5);5*3H,2H2,1H3 |
| InChIKey | LHFXLNIZVSHTRJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethanol;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;prop-2-enoic acid?
The IUPAC name of ethanol;prop-2-enoic acid (CID 159350313) is ethanol;prop-2-enoic acid.
What is the SMILES notation for ethanol;prop-2-enoic acid?
The canonical SMILES for ethanol;prop-2-enoic acid is C=CC(=O)O.CCO.CCO.CCO.CCO.CCO.
What is the InChIKey of ethanol;prop-2-enoic acid?
The InChIKey is LHFXLNIZVSHTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.5C2H6O/c1-2-3(4)5;5*1-2-3/h2H,1H2,(H,4,5);5*3H,2H2,1H3.
What are the key properties of ethanol;prop-2-enoic acid?
ethanol;prop-2-enoic acid has a molecular weight of 302.41 g/mol, XLogP of 0.25, 1 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;prop-2-enoic acid is sourced from PubChem (CID 159350313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).