About prop-2-enoic acid;silylmethanol
prop-2-enoic acid;silylmethanol (PubChem CID 175499184) has the molecular formula C4H10O3Si
and a molecular weight of 134.21 g/mol. Its IUPAC name is prop-2-enoic acid;silylmethanol.
Molecular Properties
| Compound Name | prop-2-enoic acid;silylmethanol |
| PubChem CID | 175499184 |
| Molecular Formula | C4H10O3Si |
| Molecular Weight | 134.21 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | prop-2-enoic acid;silylmethanol |
| SMILES | C=CC(=O)O.OC[SiH3] |
| InChI | InChI=1S/C3H4O2.CH6OSi/c1-2-3(4)5;2-1-3/h2H,1H2,(H,4,5);2H,1H2,3H3 |
| InChIKey | CJFVQUIGBCEFFX-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.21 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoic acid;silylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoic acid;silylmethanol?
The IUPAC name of prop-2-enoic acid;silylmethanol (CID 175499184) is prop-2-enoic acid;silylmethanol.
What is the SMILES notation for prop-2-enoic acid;silylmethanol?
The canonical SMILES for prop-2-enoic acid;silylmethanol is C=CC(=O)O.OC[SiH3].
What is the InChIKey of prop-2-enoic acid;silylmethanol?
The InChIKey is CJFVQUIGBCEFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.CH6OSi/c1-2-3(4)5;2-1-3/h2H,1H2,(H,4,5);2H,1H2,3H3.
What are the key properties of prop-2-enoic acid;silylmethanol?
prop-2-enoic acid;silylmethanol has a molecular weight of 134.21 g/mol, XLogP of -1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoic acid;silylmethanol is sourced from PubChem (CID 175499184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).