About ethenylsilane;prop-2-enoic acid
ethenylsilane;prop-2-enoic acid (PubChem CID 159736042) has the molecular formula C5H10O2Si
and a molecular weight of 130.22 g/mol. Its IUPAC name is ethenylsilane;prop-2-enoic acid.
Molecular Properties
| Compound Name | ethenylsilane;prop-2-enoic acid |
| PubChem CID | 159736042 |
| Molecular Formula | C5H10O2Si |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | ethenylsilane;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=C[SiH3] |
| InChI | InChI=1S/C3H4O2.C2H6Si/c1-2-3(4)5;1-2-3/h2H,1H2,(H,4,5);2H,1H2,3H3 |
| InChIKey | NBVWOQMOEQKZOZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethenylsilane;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylsilane;prop-2-enoic acid?
The IUPAC name of ethenylsilane;prop-2-enoic acid (CID 159736042) is ethenylsilane;prop-2-enoic acid.
What is the SMILES notation for ethenylsilane;prop-2-enoic acid?
The canonical SMILES for ethenylsilane;prop-2-enoic acid is C=CC(=O)O.C=C[SiH3].
What is the InChIKey of ethenylsilane;prop-2-enoic acid?
The InChIKey is NBVWOQMOEQKZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.C2H6Si/c1-2-3(4)5;1-2-3/h2H,1H2,(H,4,5);2H,1H2,3H3.
What are the key properties of ethenylsilane;prop-2-enoic acid?
ethenylsilane;prop-2-enoic acid has a molecular weight of 130.22 g/mol, XLogP of -0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylsilane;prop-2-enoic acid is sourced from PubChem (CID 159736042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).