C5H6O2W — CID 157079397
1,3-dihydroxypenta-2,4-dienylidenetungsten (PubChem CID 157079397) has the molecular formula C5H6O2W and a molecular weight of 281.94 g/mol. Its IUPAC name is 1,3-dihydroxypenta-2,4-dienylidenetungsten.
| Compound Name | 1,3-dihydroxypenta-2,4-dienylidenetungsten |
|---|---|
| PubChem CID | 157079397 |
| Molecular Formula | C5H6O2W |
| Molecular Weight | 281.94 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 1,3-dihydroxypenta-2,4-dienylidenetungsten |
| SMILES | C=CC(O)=CC(O)=[W] |
| InChI | InChI=1S/C5H6O2.W/c1-2-5(7)3-4-6;/h2-3,6-7H,1H2; |
| InChIKey | HADQKBRHYGFZEC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.94 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|