C16H36O — CID 143333385
but-1-ene;ethane;(3E)-hexa-1,3-dien-3-ol (PubChem CID 143333385) has the molecular formula C16H36O and a molecular weight of 244.46 g/mol. Its IUPAC name is but-1-ene;ethane;(3E)-hexa-1,3-dien-3-ol.
| Compound Name | but-1-ene;ethane;(3E)-hexa-1,3-dien-3-ol |
|---|---|
| PubChem CID | 143333385 |
| Molecular Formula | C16H36O |
| Molecular Weight | 244.46 g/mol |
| Exact Mass | 244.28 |
| IUPAC Name | but-1-ene;ethane;(3E)-hexa-1,3-dien-3-ol |
| SMILES | C=C/C(O)=C\CC.C=CCC.CC.CC.CC |
| InChI | InChI=1S/C6H10O.C4H8.3C2H6/c1-3-5-6(7)4-2;1-3-4-2;3*1-2/h4-5,7H,2-3H2,1H3;3H,1,4H2,2H3;3*1-2H3/b6-5+;;;; |
| InChIKey | AXNRVPFLKJDYLT-WPYDVODASA-N |
| XLogP | 6.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.46 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|