C16H32 — CID 143290103
ethane;(4E)-4-ethenylhepta-1,4-diene;prop-1-ene (PubChem CID 143290103) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is ethane;(4E)-4-ethenylhepta-1,4-diene;prop-1-ene.
| Compound Name | ethane;(4E)-4-ethenylhepta-1,4-diene;prop-1-ene |
|---|---|
| PubChem CID | 143290103 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | ethane;(4E)-4-ethenylhepta-1,4-diene;prop-1-ene |
| SMILES | C=CC.C=CC/C(C=C)=C\CC.CC.CC |
| InChI | InChI=1S/C9H14.C3H6.2C2H6/c1-4-7-9(6-3)8-5-2;1-3-2;2*1-2/h4,6,8H,1,3,5,7H2,2H3;3H,1H2,2H3;2*1-2H3/b9-8-;;; |
| InChIKey | JLTKDYZWHLJPFT-DQNNFYOXSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|