C11H18 — CID 91412831
4-but-2-en-2-ylhepta-1,4-diene (PubChem CID 91412831) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 4-but-2-en-2-ylhepta-1,4-diene.
| Compound Name | 4-but-2-en-2-ylhepta-1,4-diene |
|---|---|
| PubChem CID | 91412831 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 4-but-2-en-2-ylhepta-1,4-diene |
| SMILES | C=CCC(=CCC)C(C)=CC |
| InChI | InChI=1S/C11H18/c1-5-8-11(9-6-2)10(4)7-3/h5,7,9H,1,6,8H2,2-4H3 |
| InChIKey | IGVAVGDFRKDGAH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|