About tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene
tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene (PubChem CID 160606549) has the molecular formula C40H80
and a molecular weight of 561.08 g/mol. Its IUPAC name is tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene.
Molecular Properties
| Compound Name | tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene |
| PubChem CID | 160606549 |
| Molecular Formula | C40H80 |
| Molecular Weight | 561.08 g/mol |
| Exact Mass | 560.63 |
| IUPAC Name | tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CCC.C=CCC.C=CCC.CCC=C(C)C.CCC=CCC.CCC=CCC.CCC=CCC |
| InChI | InChI=1S/4C6H12.4C4H8/c1-4-5-6(2)3;3*1-3-5-6-4-2;1-4(2)3;3*1-3-4-2/h5H,4H2,1-3H3;3*5-6H,3-4H2,1-2H3;1H2,2-3H3;3*3H,1,4H2,2H3 |
| InChIKey | REYGDGXCKVWVFR-UHFFFAOYSA-N |
| XLogP | 15.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.08 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene?
The IUPAC name of tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene (CID 160606549) is tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene.
What is the SMILES notation for tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene?
The canonical SMILES for tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene is C=C(C)C.C=CCC.C=CCC.C=CCC.CCC=C(C)C.CCC=CCC.CCC=CCC.CCC=CCC.
What is the InChIKey of tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene?
The InChIKey is REYGDGXCKVWVFR-UHFFFAOYSA-N. The full InChI is InChI=1S/4C6H12.4C4H8/c1-4-5-6(2)3;3*1-3-5-6-4-2;1-4(2)3;3*1-3-4-2/h5H,4H2,1-3H3;3*5-6H,3-4H2,1-2H3;1H2,2-3H3;3*3H,1,4H2,2H3.
What are the key properties of tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene?
tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene has a molecular weight of 561.08 g/mol, XLogP of 15.78, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(but-1-ene);tris(hex-3-ene);2-methylpent-2-ene;2-methylprop-1-ene is sourced from PubChem (CID 160606549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).