About carbon dioxide;2-methylpent-2-ene
carbon dioxide;2-methylpent-2-ene (PubChem CID 174340897) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is carbon dioxide;2-methylpent-2-ene.
Molecular Properties
| Compound Name | carbon dioxide;2-methylpent-2-ene |
| PubChem CID | 174340897 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | carbon dioxide;2-methylpent-2-ene |
| SMILES | CCC=C(C)C.O=C=O |
| InChI | InChI=1S/C6H12.CO2/c1-4-5-6(2)3;2-1-3/h5H,4H2,1-3H3; |
| InChIKey | RYIBDPOGMGAFDX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;2-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;2-methylpent-2-ene?
The IUPAC name of carbon dioxide;2-methylpent-2-ene (CID 174340897) is carbon dioxide;2-methylpent-2-ene.
What is the SMILES notation for carbon dioxide;2-methylpent-2-ene?
The canonical SMILES for carbon dioxide;2-methylpent-2-ene is CCC=C(C)C.O=C=O.
What is the InChIKey of carbon dioxide;2-methylpent-2-ene?
The InChIKey is RYIBDPOGMGAFDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.CO2/c1-4-5-6(2)3;2-1-3/h5H,4H2,1-3H3;.
What are the key properties of carbon dioxide;2-methylpent-2-ene?
carbon dioxide;2-methylpent-2-ene has a molecular weight of 128.17 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-methylpent-2-ene is sourced from PubChem (CID 174340897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).