About 2-methylhex-2-ene;oxalonitrile
2-methylhex-2-ene;oxalonitrile (PubChem CID 174896444) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-methylhex-2-ene;oxalonitrile.
Molecular Properties
| Compound Name | 2-methylhex-2-ene;oxalonitrile |
| PubChem CID | 174896444 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-methylhex-2-ene;oxalonitrile |
| SMILES | CCCC=C(C)C.N#CC#N |
| InChI | InChI=1S/C7H14.C2N2/c1-4-5-6-7(2)3;3-1-2-4/h6H,4-5H2,1-3H3; |
| InChIKey | IRXFIPRYAHOGRV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhex-2-ene;oxalonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhex-2-ene;oxalonitrile?
The IUPAC name of 2-methylhex-2-ene;oxalonitrile (CID 174896444) is 2-methylhex-2-ene;oxalonitrile.
What is the SMILES notation for 2-methylhex-2-ene;oxalonitrile?
The canonical SMILES for 2-methylhex-2-ene;oxalonitrile is CCCC=C(C)C.N#CC#N.
What is the InChIKey of 2-methylhex-2-ene;oxalonitrile?
The InChIKey is IRXFIPRYAHOGRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C2N2/c1-4-5-6-7(2)3;3-1-2-4/h6H,4-5H2,1-3H3;.
What are the key properties of 2-methylhex-2-ene;oxalonitrile?
2-methylhex-2-ene;oxalonitrile has a molecular weight of 150.22 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhex-2-ene;oxalonitrile is sourced from PubChem (CID 174896444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).