About (3Z,5Z)-5-methylnona-3,5-dienenitrile
(3Z,5Z)-5-methylnona-3,5-dienenitrile (PubChem CID 143786949) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is (3Z,5Z)-5-methylnona-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3Z,5Z)-5-methylnona-3,5-dienenitrile |
| PubChem CID | 143786949 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3Z,5Z)-5-methylnona-3,5-dienenitrile |
| SMILES | CCC/C=C(C)\C=C/CC#N |
| InChI | InChI=1S/C10H15N/c1-3-4-7-10(2)8-5-6-9-11/h5,7-8H,3-4,6H2,1-2H3/b8-5-,10-7- |
| InChIKey | AGUXRSZRRDMKBR-OUOSTHCTSA-N |
| XLogP | 3.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-5-methylnona-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-5-methylnona-3,5-dienenitrile?
The IUPAC name of (3Z,5Z)-5-methylnona-3,5-dienenitrile (CID 143786949) is (3Z,5Z)-5-methylnona-3,5-dienenitrile.
What is the SMILES notation for (3Z,5Z)-5-methylnona-3,5-dienenitrile?
The canonical SMILES for (3Z,5Z)-5-methylnona-3,5-dienenitrile is CCC/C=C(C)\C=C/CC#N.
What is the InChIKey of (3Z,5Z)-5-methylnona-3,5-dienenitrile?
The InChIKey is AGUXRSZRRDMKBR-OUOSTHCTSA-N. The full InChI is InChI=1S/C10H15N/c1-3-4-7-10(2)8-5-6-9-11/h5,7-8H,3-4,6H2,1-2H3/b8-5-,10-7-.
What are the key properties of (3Z,5Z)-5-methylnona-3,5-dienenitrile?
(3Z,5Z)-5-methylnona-3,5-dienenitrile has a molecular weight of 149.24 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-5-methylnona-3,5-dienenitrile is sourced from PubChem (CID 143786949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).