C10H15N — CID 143786949
(3Z,5Z)-5-methylnona-3,5-dienenitrile (PubChem CID 143786949) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (3Z,5Z)-5-methylnona-3,5-dienenitrile.
| Compound Name | (3Z,5Z)-5-methylnona-3,5-dienenitrile |
|---|---|
| PubChem CID | 143786949 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3Z,5Z)-5-methylnona-3,5-dienenitrile |
| SMILES | CCC/C=C(C)\C=C/CC#N |
| InChI | InChI=1S/C10H15N/c1-3-4-7-10(2)8-5-6-9-11/h5,7-8H,3-4,6H2,1-2H3/b8-5-,10-7- |
| InChIKey | AGUXRSZRRDMKBR-OUOSTHCTSA-N |
| XLogP | 3.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|