C10H14 — CID 143682413
(4Z,6Z)-6-methylnona-4,6-dien-1-yne (PubChem CID 143682413) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (4Z,6Z)-6-methylnona-4,6-dien-1-yne.
| Compound Name | (4Z,6Z)-6-methylnona-4,6-dien-1-yne |
|---|---|
| PubChem CID | 143682413 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (4Z,6Z)-6-methylnona-4,6-dien-1-yne |
| SMILES | C#CC/C=C\C(C)=C/CC |
| InChI | InChI=1S/C10H14/c1-4-6-7-9-10(3)8-5-2/h1,7-9H,5-6H2,2-3H3/b9-7-,10-8- |
| InChIKey | XMPCYTQVGPPXNM-XOHWUJONSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|