C12H22 — CID 142050106
ethane;(2Z,4Z,6E)-6-methylnona-2,4,6-triene (PubChem CID 142050106) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is ethane;(2Z,4Z,6E)-6-methylnona-2,4,6-triene.
| Compound Name | ethane;(2Z,4Z,6E)-6-methylnona-2,4,6-triene |
|---|---|
| PubChem CID | 142050106 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | ethane;(2Z,4Z,6E)-6-methylnona-2,4,6-triene |
| SMILES | C/C=C\C=C/C(C)=C/CC.CC |
| InChI | InChI=1S/C10H16.C2H6/c1-4-6-7-9-10(3)8-5-2;1-2/h4,6-9H,5H2,1-3H3;1-2H3/b6-4-,9-7-,10-8+; |
| InChIKey | WXRURXQTLUQSRZ-ALCIFHIYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|