C18H32 — CID 144597093
benzene;ethane;(2Z,4Z)-4-methylhepta-2,4-diene (PubChem CID 144597093) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is benzene;ethane;(2Z,4Z)-4-methylhepta-2,4-diene.
| Compound Name | benzene;ethane;(2Z,4Z)-4-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 144597093 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | benzene;ethane;(2Z,4Z)-4-methylhepta-2,4-diene |
| SMILES | C/C=C\C(C)=C/CC.CC.CC.c1ccccc1 |
| InChI | InChI=1S/C8H14.C6H6.2C2H6/c1-4-6-8(3)7-5-2;1-2-4-6-5-3-1;2*1-2/h4,6-7H,5H2,1-3H3;1-6H;2*1-2H3/b6-4-,8-7-;;; |
| InChIKey | GAOIRDZLVASCCH-GLMBCOHHSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|