C10H15Cl — CID 142050901
(2Z,4Z,6Z)-6-chloro-4-methylnona-2,4,6-triene (PubChem CID 142050901) has the molecular formula C10H15Cl and a molecular weight of 170.68 g/mol. Its IUPAC name is (2Z,4Z,6Z)-6-chloro-4-methylnona-2,4,6-triene.
| Compound Name | (2Z,4Z,6Z)-6-chloro-4-methylnona-2,4,6-triene |
|---|---|
| PubChem CID | 142050901 |
| Molecular Formula | C10H15Cl |
| Molecular Weight | 170.68 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2Z,4Z,6Z)-6-chloro-4-methylnona-2,4,6-triene |
| SMILES | C/C=C\C(C)=C/C(Cl)=C/CC |
| InChI | InChI=1S/C10H15Cl/c1-4-6-9(3)8-10(11)7-5-2/h4,6-8H,5H2,1-3H3/b6-4-,9-8-,10-7- |
| InChIKey | CYRHEOIPNNDCKD-FQUDOGMCSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|