3-methylhexa-2,4-dienoyl chloride

C7H9ClO — CID 71402233

IUPAC3-methylhexa-2,4-dienoyl chloride
SMILESCC=CC(C)=CC(=O)Cl
InChIInChI=1S/C7H9ClO/c1-3-4-6(2)5-7(8)9/h3-5H,1-2H3
InChIKeyAMUAAMAKGLXTCS-UHFFFAOYSA-N
MW144.60 g/mol
LogP2.27
Rot. Bonds2

About 3-methylhexa-2,4-dienoyl chloride

3-methylhexa-2,4-dienoyl chloride (PubChem CID 71402233) has the molecular formula C7H9ClO and a molecular weight of 144.60 g/mol. Its IUPAC name is 3-methylhexa-2,4-dienoyl chloride.

Molecular Properties

Compound Name3-methylhexa-2,4-dienoyl chloride
PubChem CID71402233
Molecular FormulaC7H9ClO
Molecular Weight144.60 g/mol
Exact Mass144.03
IUPAC Name3-methylhexa-2,4-dienoyl chloride
SMILESCC=CC(C)=CC(=O)Cl
InChIInChI=1S/C7H9ClO/c1-3-4-6(2)5-7(8)9/h3-5H,1-2H3
InChIKeyAMUAAMAKGLXTCS-UHFFFAOYSA-N
XLogP2.27
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.60
LogP ≤ 52.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 3-methylhexa-2,4-dienoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylhexa-2,4-dienoyl chloride?
The IUPAC name of 3-methylhexa-2,4-dienoyl chloride (CID 71402233) is 3-methylhexa-2,4-dienoyl chloride.
What is the SMILES notation for 3-methylhexa-2,4-dienoyl chloride?
The canonical SMILES for 3-methylhexa-2,4-dienoyl chloride is CC=CC(C)=CC(=O)Cl.
What is the InChIKey of 3-methylhexa-2,4-dienoyl chloride?
The InChIKey is AMUAAMAKGLXTCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClO/c1-3-4-6(2)5-7(8)9/h3-5H,1-2H3.
What are the key properties of 3-methylhexa-2,4-dienoyl chloride?
3-methylhexa-2,4-dienoyl chloride has a molecular weight of 144.60 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexa-2,4-dienoyl chloride is sourced from PubChem (CID 71402233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).