C8H13NO — CID 143215633
N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]acetamide (PubChem CID 143215633) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]acetamide.
| Compound Name | N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 143215633 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]acetamide |
| SMILES | C/C=C\C(C)=C/NC(C)=O |
| InChI | InChI=1S/C8H13NO/c1-4-5-7(2)6-9-8(3)10/h4-6H,1-3H3,(H,9,10)/b5-4-,7-6- |
| InChIKey | MPCXNAKWJOGCCJ-RZSVFLSASA-N |
| XLogP | 1.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|