C7H12N2O2 — CID 131238300
(E)-3-acetamido-N,N-dimethylprop-2-enamide (PubChem CID 131238300) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is (E)-3-acetamido-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-acetamido-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 131238300 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (E)-3-acetamido-N,N-dimethylprop-2-enamide |
| SMILES | CC(=O)N/C=C/C(=O)N(C)C |
| InChI | InChI=1S/C7H12N2O2/c1-6(10)8-5-4-7(11)9(2)3/h4-5H,1-3H3,(H,8,10)/b5-4+ |
| InChIKey | PPLWSESVMIHDPC-SNAWJCMRSA-N |
| XLogP | -0.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|