C9H19NO — CID 162375612
(E)-N,N-dimethylpent-2-enamide;ethane (PubChem CID 162375612) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (E)-N,N-dimethylpent-2-enamide;ethane.
| Compound Name | (E)-N,N-dimethylpent-2-enamide;ethane |
|---|---|
| PubChem CID | 162375612 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (E)-N,N-dimethylpent-2-enamide;ethane |
| SMILES | CC.CC/C=C/C(=O)N(C)C |
| InChI | InChI=1S/C7H13NO.C2H6/c1-4-5-6-7(9)8(2)3;1-2/h5-6H,4H2,1-3H3;1-2H3/b6-5+; |
| InChIKey | FLDCDDUVYOJPNV-IPZCTEOASA-N |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|