About pent-2-enoic acid;hydrochloride
pent-2-enoic acid;hydrochloride (PubChem CID 156883966) has the molecular formula C5H9ClO2
and a molecular weight of 136.58 g/mol. Its IUPAC name is pent-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | pent-2-enoic acid;hydrochloride |
| PubChem CID | 156883966 |
| Molecular Formula | C5H9ClO2 |
| Molecular Weight | 136.58 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | pent-2-enoic acid;hydrochloride |
| SMILES | CCC=CC(=O)O.Cl |
| InChI | InChI=1S/C5H8O2.ClH/c1-2-3-4-5(6)7;/h3-4H,2H2,1H3,(H,6,7);1H |
| InChIKey | ZPDAMJUVFAXDKE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze pent-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-2-enoic acid;hydrochloride?
The IUPAC name of pent-2-enoic acid;hydrochloride (CID 156883966) is pent-2-enoic acid;hydrochloride.
What is the SMILES notation for pent-2-enoic acid;hydrochloride?
The canonical SMILES for pent-2-enoic acid;hydrochloride is CCC=CC(=O)O.Cl.
What is the InChIKey of pent-2-enoic acid;hydrochloride?
The InChIKey is ZPDAMJUVFAXDKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.ClH/c1-2-3-4-5(6)7;/h3-4H,2H2,1H3,(H,6,7);1H.
What are the key properties of pent-2-enoic acid;hydrochloride?
pent-2-enoic acid;hydrochloride has a molecular weight of 136.58 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pent-2-enoic acid;hydrochloride is sourced from PubChem (CID 156883966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).