About octadec-2-enoic acid;hydrochloride
octadec-2-enoic acid;hydrochloride (PubChem CID 175477245) has the molecular formula C18H35ClO2
and a molecular weight of 318.93 g/mol. Its IUPAC name is octadec-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | octadec-2-enoic acid;hydrochloride |
| PubChem CID | 175477245 |
| Molecular Formula | C18H35ClO2 |
| Molecular Weight | 318.93 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | octadec-2-enoic acid;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCC=CC(=O)O.Cl |
| InChI | InChI=1S/C18H34O2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h16-17H,2-15H2,1H3,(H,19,20);1H |
| InChIKey | LFCKIJCOJAQYNT-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.93 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze octadec-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-2-enoic acid;hydrochloride?
The IUPAC name of octadec-2-enoic acid;hydrochloride (CID 175477245) is octadec-2-enoic acid;hydrochloride.
What is the SMILES notation for octadec-2-enoic acid;hydrochloride?
The canonical SMILES for octadec-2-enoic acid;hydrochloride is CCCCCCCCCCCCCCCC=CC(=O)O.Cl.
What is the InChIKey of octadec-2-enoic acid;hydrochloride?
The InChIKey is LFCKIJCOJAQYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h16-17H,2-15H2,1H3,(H,19,20);1H.
What are the key properties of octadec-2-enoic acid;hydrochloride?
octadec-2-enoic acid;hydrochloride has a molecular weight of 318.93 g/mol, XLogP of 6.53, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-2-enoic acid;hydrochloride is sourced from PubChem (CID 175477245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).