About alumane;hexadec-2-enoic acid
alumane;hexadec-2-enoic acid (PubChem CID 174818671) has the molecular formula C16H33AlO2
and a molecular weight of 284.42 g/mol. Its IUPAC name is alumane;hexadec-2-enoic acid.
Molecular Properties
| Compound Name | alumane;hexadec-2-enoic acid |
| PubChem CID | 174818671 |
| Molecular Formula | C16H33AlO2 |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | alumane;hexadec-2-enoic acid |
| SMILES | CCCCCCCCCCCCCC=CC(=O)O.[AlH3] |
| InChI | InChI=1S/C16H30O2.Al.3H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;;;;/h14-15H,2-13H2,1H3,(H,17,18);;;; |
| InChIKey | FGAXVKCOBRZPPZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze alumane;hexadec-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;hexadec-2-enoic acid?
The IUPAC name of alumane;hexadec-2-enoic acid (CID 174818671) is alumane;hexadec-2-enoic acid.
What is the SMILES notation for alumane;hexadec-2-enoic acid?
The canonical SMILES for alumane;hexadec-2-enoic acid is CCCCCCCCCCCCCC=CC(=O)O.[AlH3].
What is the InChIKey of alumane;hexadec-2-enoic acid?
The InChIKey is FGAXVKCOBRZPPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2.Al.3H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;;;;/h14-15H,2-13H2,1H3,(H,17,18);;;;.
What are the key properties of alumane;hexadec-2-enoic acid?
alumane;hexadec-2-enoic acid has a molecular weight of 284.42 g/mol, XLogP of 4.14, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;hexadec-2-enoic acid is sourced from PubChem (CID 174818671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).