About copper;heptadec-2-enoic acid
copper;heptadec-2-enoic acid (PubChem CID 174878538) has the molecular formula C17H32CuO2
and a molecular weight of 331.99 g/mol. Its IUPAC name is copper;heptadec-2-enoic acid.
Molecular Properties
| Compound Name | copper;heptadec-2-enoic acid |
| PubChem CID | 174878538 |
| Molecular Formula | C17H32CuO2 |
| Molecular Weight | 331.99 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | copper;heptadec-2-enoic acid |
| SMILES | CCCCCCCCCCCCCCC=CC(=O)O.[Cu] |
| InChI | InChI=1S/C17H32O2.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19;/h15-16H,2-14H2,1H3,(H,18,19); |
| InChIKey | BWHNMVMMCCMZJH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.99 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper;heptadec-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;heptadec-2-enoic acid?
The IUPAC name of copper;heptadec-2-enoic acid (CID 174878538) is copper;heptadec-2-enoic acid.
What is the SMILES notation for copper;heptadec-2-enoic acid?
The canonical SMILES for copper;heptadec-2-enoic acid is CCCCCCCCCCCCCCC=CC(=O)O.[Cu].
What is the InChIKey of copper;heptadec-2-enoic acid?
The InChIKey is BWHNMVMMCCMZJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O2.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19;/h15-16H,2-14H2,1H3,(H,18,19);.
What are the key properties of copper;heptadec-2-enoic acid?
copper;heptadec-2-enoic acid has a molecular weight of 331.99 g/mol, XLogP of 5.72, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper;heptadec-2-enoic acid is sourced from PubChem (CID 174878538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).