C11H21NO — CID 176757797
(E)-N,N,6,6-tetramethylhept-2-enamide (PubChem CID 176757797) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (E)-N,N,6,6-tetramethylhept-2-enamide.
| Compound Name | (E)-N,N,6,6-tetramethylhept-2-enamide |
|---|---|
| PubChem CID | 176757797 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (E)-N,N,6,6-tetramethylhept-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CCC(C)(C)C |
| InChI | InChI=1S/C11H21NO/c1-11(2,3)9-7-6-8-10(13)12(4)5/h6,8H,7,9H2,1-5H3/b8-6+ |
| InChIKey | FHWYIQCHKLBDBH-SOFGYWHQSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|