C12H21N3O4 — CID 146363470
(E,2S)-7-(dimethylamino)-2-(dimethylcarbamoylamino)-7-oxohept-5-enoic acid (PubChem CID 146363470) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is (E,2S)-7-(dimethylamino)-2-(dimethylcarbamoylamino)-7-oxohept-5-enoic acid.
| Compound Name | (E,2S)-7-(dimethylamino)-2-(dimethylcarbamoylamino)-7-oxohept-5-enoic acid |
|---|---|
| PubChem CID | 146363470 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | (E,2S)-7-(dimethylamino)-2-(dimethylcarbamoylamino)-7-oxohept-5-enoic acid |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](NC(=O)N(C)C)C(=O)O |
| InChI | InChI=1S/C12H21N3O4/c1-14(2)10(16)8-6-5-7-9(11(17)18)13-12(19)15(3)4/h6,8-9H,5,7H2,1-4H3,(H,13,19)(H,17,18)/b8-6+/t9-/m0/s1 |
| InChIKey | MHJQYUDXRQSMKZ-ORZBULNSSA-N |
| XLogP | 0.14 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|