C7H12FNO — CID 141430531
5-fluoro-N,N-dimethylpent-2-enamide (PubChem CID 141430531) has the molecular formula C7H12FNO and a molecular weight of 145.18 g/mol. Its IUPAC name is 5-fluoro-N,N-dimethylpent-2-enamide.
| Compound Name | 5-fluoro-N,N-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 141430531 |
| Molecular Formula | C7H12FNO |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 5-fluoro-N,N-dimethylpent-2-enamide |
| SMILES | CN(C)C(=O)C=CCCF |
| InChI | InChI=1S/C7H12FNO/c1-9(2)7(10)5-3-4-6-8/h3,5H,4,6H2,1-2H3 |
| InChIKey | MFQJVCPULWMBCT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|