C9H16N2O3 — CID 146349443
(E,2S)-2-amino-7-(dimethylamino)-7-oxohept-5-enoic acid (PubChem CID 146349443) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is (E,2S)-2-amino-7-(dimethylamino)-7-oxohept-5-enoic acid.
| Compound Name | (E,2S)-2-amino-7-(dimethylamino)-7-oxohept-5-enoic acid |
|---|---|
| PubChem CID | 146349443 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (E,2S)-2-amino-7-(dimethylamino)-7-oxohept-5-enoic acid |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H16N2O3/c1-11(2)8(12)6-4-3-5-7(10)9(13)14/h4,6-7H,3,5,10H2,1-2H3,(H,13,14)/b6-4+/t7-/m0/s1 |
| InChIKey | MNEALVCZGXLLJP-KNIZRNDPSA-N |
| XLogP | -0.18 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|