C13H27N3O3 — CID 137348989
(2S,10R)-2,10-diamino-11-(dimethylamino)-11-oxoundecanoic acid (PubChem CID 137348989) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is (2S,10R)-2,10-diamino-11-(dimethylamino)-11-oxoundecanoic acid.
| Compound Name | (2S,10R)-2,10-diamino-11-(dimethylamino)-11-oxoundecanoic acid |
|---|---|
| PubChem CID | 137348989 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (2S,10R)-2,10-diamino-11-(dimethylamino)-11-oxoundecanoic acid |
| SMILES | CN(C)C(=O)[C@H](N)CCCCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C13H27N3O3/c1-16(2)12(17)10(14)8-6-4-3-5-7-9-11(15)13(18)19/h10-11H,3-9,14-15H2,1-2H3,(H,18,19)/t10-,11+/m1/s1 |
| InChIKey | DSPAEOWBCAUTMS-MNOVXSKESA-N |
| XLogP | 0.54 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|