C9H13NO2 — CID 137379587
N,N-dimethyl-7-oxohepta-2,4-dienamide (PubChem CID 137379587) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is N,N-dimethyl-7-oxohepta-2,4-dienamide.
| Compound Name | N,N-dimethyl-7-oxohepta-2,4-dienamide |
|---|---|
| PubChem CID | 137379587 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N,N-dimethyl-7-oxohepta-2,4-dienamide |
| SMILES | CN(C)C(=O)C=CC=CCC=O |
| InChI | InChI=1S/C9H13NO2/c1-10(2)9(12)7-5-3-4-6-8-11/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | DHWUHKFKNVDYSG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|