C18H25NO — CID 123909046
N,N-dimethyl-10-phenyldeca-2,4-dienamide (PubChem CID 123909046) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is N,N-dimethyl-10-phenyldeca-2,4-dienamide.
| Compound Name | N,N-dimethyl-10-phenyldeca-2,4-dienamide |
|---|---|
| PubChem CID | 123909046 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N,N-dimethyl-10-phenyldeca-2,4-dienamide |
| SMILES | CN(C)C(=O)C=CC=CCCCCCc1ccccc1 |
| InChI | InChI=1S/C18H25NO/c1-19(2)18(20)16-12-7-5-3-4-6-9-13-17-14-10-8-11-15-17/h5,7-8,10-12,14-16H,3-4,6,9,13H2,1-2H3 |
| InChIKey | ZUUAKMNXLJAPSE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|