C18H25NO — CID 121306712
N-methyl-N-[(2E,4E)-10-phenyldeca-2,4-dienyl]formamide (PubChem CID 121306712) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is N-methyl-N-[(2E,4E)-10-phenyldeca-2,4-dienyl]formamide.
| Compound Name | N-methyl-N-[(2E,4E)-10-phenyldeca-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 121306712 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-methyl-N-[(2E,4E)-10-phenyldeca-2,4-dienyl]formamide |
| SMILES | CN(C=O)C/C=C/C=C/CCCCCc1ccccc1 |
| InChI | InChI=1S/C18H25NO/c1-19(17-20)16-12-7-5-3-2-4-6-9-13-18-14-10-8-11-15-18/h3,5,7-8,10-12,14-15,17H,2,4,6,9,13,16H2,1H3/b5-3+,12-7+ |
| InChIKey | DEAATENKENBQSU-PPRDQHCASA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|