C17H23NO — CID 123716646
N,N-dimethyl-9-phenylnona-2,4-dienamide (PubChem CID 123716646) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is N,N-dimethyl-9-phenylnona-2,4-dienamide.
| Compound Name | N,N-dimethyl-9-phenylnona-2,4-dienamide |
|---|---|
| PubChem CID | 123716646 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | N,N-dimethyl-9-phenylnona-2,4-dienamide |
| SMILES | CN(C)C(=O)C=CC=CCCCCc1ccccc1 |
| InChI | InChI=1S/C17H23NO/c1-18(2)17(19)15-11-6-4-3-5-8-12-16-13-9-7-10-14-16/h4,6-7,9-11,13-15H,3,5,8,12H2,1-2H3 |
| InChIKey | LCGQGEPFLUDJDN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|