About ethyl (E)-9-phenylnon-2-enoate
ethyl (E)-9-phenylnon-2-enoate (PubChem CID 10753852) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is ethyl (E)-9-phenylnon-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-9-phenylnon-2-enoate |
| PubChem CID | 10753852 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | ethyl (E)-9-phenylnon-2-enoate |
| SMILES | CCOC(=O)/C=C/CCCCCCc1ccccc1 |
| InChI | InChI=1S/C17H24O2/c1-2-19-17(18)15-11-6-4-3-5-8-12-16-13-9-7-10-14-16/h7,9-11,13-15H,2-6,8,12H2,1H3/b15-11+ |
| InChIKey | JPGBRKLPDUTGNF-RVDMUPIBSA-N |
| XLogP | 4.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-9-phenylnon-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-9-phenylnon-2-enoate?
The IUPAC name of ethyl (E)-9-phenylnon-2-enoate (CID 10753852) is ethyl (E)-9-phenylnon-2-enoate.
What is the SMILES notation for ethyl (E)-9-phenylnon-2-enoate?
The canonical SMILES for ethyl (E)-9-phenylnon-2-enoate is CCOC(=O)/C=C/CCCCCCc1ccccc1.
What is the InChIKey of ethyl (E)-9-phenylnon-2-enoate?
The InChIKey is JPGBRKLPDUTGNF-RVDMUPIBSA-N. The full InChI is InChI=1S/C17H24O2/c1-2-19-17(18)15-11-6-4-3-5-8-12-16-13-9-7-10-14-16/h7,9-11,13-15H,2-6,8,12H2,1H3/b15-11+.
What are the key properties of ethyl (E)-9-phenylnon-2-enoate?
ethyl (E)-9-phenylnon-2-enoate has a molecular weight of 260.38 g/mol, XLogP of 4.30, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-9-phenylnon-2-enoate is sourced from PubChem (CID 10753852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).