About 9-phenylnon-2-enamide
9-phenylnon-2-enamide (PubChem CID 123957146) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 9-phenylnon-2-enamide.
Molecular Properties
| Compound Name | 9-phenylnon-2-enamide |
| PubChem CID | 123957146 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 9-phenylnon-2-enamide |
| SMILES | NC(=O)C=CCCCCCCc1ccccc1 |
| InChI | InChI=1S/C15H21NO/c16-15(17)13-9-4-2-1-3-6-10-14-11-7-5-8-12-14/h5,7-9,11-13H,1-4,6,10H2,(H2,16,17) |
| InChIKey | SJXUPCUYQCSMPP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 9-phenylnon-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenylnon-2-enamide?
The IUPAC name of 9-phenylnon-2-enamide (CID 123957146) is 9-phenylnon-2-enamide.
What is the SMILES notation for 9-phenylnon-2-enamide?
The canonical SMILES for 9-phenylnon-2-enamide is NC(=O)C=CCCCCCCc1ccccc1.
What is the InChIKey of 9-phenylnon-2-enamide?
The InChIKey is SJXUPCUYQCSMPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c16-15(17)13-9-4-2-1-3-6-10-14-11-7-5-8-12-14/h5,7-9,11-13H,1-4,6,10H2,(H2,16,17).
What are the key properties of 9-phenylnon-2-enamide?
9-phenylnon-2-enamide has a molecular weight of 231.34 g/mol, XLogP of 3.22, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenylnon-2-enamide is sourced from PubChem (CID 123957146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).