C24H38O3 — CID 67655950
(Z)-2-hydroxy-18-phenyloctadec-9-enoic acid (PubChem CID 67655950) has the molecular formula C24H38O3 and a molecular weight of 374.56 g/mol. Its IUPAC name is (Z)-2-hydroxy-18-phenyloctadec-9-enoic acid.
| Compound Name | (Z)-2-hydroxy-18-phenyloctadec-9-enoic acid |
|---|---|
| PubChem CID | 67655950 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (Z)-2-hydroxy-18-phenyloctadec-9-enoic acid |
| SMILES | O=C(O)C(O)CCCCCC/C=C\CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C24H38O3/c25-23(24(26)27)21-17-12-10-8-6-4-2-1-3-5-7-9-11-14-18-22-19-15-13-16-20-22/h2,4,13,15-16,19-20,23,25H,1,3,5-12,14,17-18,21H2,(H,26,27)/b4-2- |
| InChIKey | SFXBQLFNNZJYNF-RQOWECAXSA-N |
| XLogP | 6.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|