C18H32O6 — CID 46781328
(Z)-2,17-dihydroxyoctadec-9-enedioic acid (PubChem CID 46781328) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is (Z)-2,17-dihydroxyoctadec-9-enedioic acid.
| Compound Name | (Z)-2,17-dihydroxyoctadec-9-enedioic acid |
|---|---|
| PubChem CID | 46781328 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (Z)-2,17-dihydroxyoctadec-9-enedioic acid |
| SMILES | O=C(O)C(O)CCCCCC/C=C\CCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C18H32O6/c19-15(17(21)22)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(20)18(23)24/h1-2,15-16,19-20H,3-14H2,(H,21,22)(H,23,24)/b2-1- |
| InChIKey | VUMVUTUEGSVYTI-UPHRSURJSA-N |
| XLogP | 3.11 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|