2,10-dihydroxydecanoic acid

C10H20O4 — CID 23158566

IUPAC2,10-dihydroxydecanoic acid
SMILESO=C(O)C(O)CCCCCCCCO
InChIInChI=1S/C10H20O4/c11-8-6-4-2-1-3-5-7-9(12)10(13)14/h9,11-12H,1-8H2,(H,13,14)
InChIKeyVWDIPHMLEMITKG-UHFFFAOYSA-N
MW204.27 g/mol
LogP1.15
Rot. Bonds9

About 2,10-dihydroxydecanoic acid

2,10-dihydroxydecanoic acid (PubChem CID 23158566) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,10-dihydroxydecanoic acid.

Molecular Properties

Compound Name2,10-dihydroxydecanoic acid
PubChem CID23158566
Molecular FormulaC10H20O4
Molecular Weight204.27 g/mol
Exact Mass204.14
IUPAC Name2,10-dihydroxydecanoic acid
SMILESO=C(O)C(O)CCCCCCCCO
InChIInChI=1S/C10H20O4/c11-8-6-4-2-1-3-5-7-9(12)10(13)14/h9,11-12H,1-8H2,(H,13,14)
InChIKeyVWDIPHMLEMITKG-UHFFFAOYSA-N
XLogP1.15
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.27
LogP ≤ 51.15
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,10-dihydroxydecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,10-dihydroxydecanoic acid?
The IUPAC name of 2,10-dihydroxydecanoic acid (CID 23158566) is 2,10-dihydroxydecanoic acid.
What is the SMILES notation for 2,10-dihydroxydecanoic acid?
The canonical SMILES for 2,10-dihydroxydecanoic acid is O=C(O)C(O)CCCCCCCCO.
What is the InChIKey of 2,10-dihydroxydecanoic acid?
The InChIKey is VWDIPHMLEMITKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c11-8-6-4-2-1-3-5-7-9(12)10(13)14/h9,11-12H,1-8H2,(H,13,14).
What are the key properties of 2,10-dihydroxydecanoic acid?
2,10-dihydroxydecanoic acid has a molecular weight of 204.27 g/mol, XLogP of 1.15, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-dihydroxydecanoic acid is sourced from PubChem (CID 23158566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).