(2R)-7-amino-2-hydroxyheptanoic acid

C7H15NO3 — CID 144842569

IUPAC(2R)-7-amino-2-hydroxyheptanoic acid
SMILESNCCCCC[C@@H](O)C(=O)O
InChIInChI=1S/C7H15NO3/c8-5-3-1-2-4-6(9)7(10)11/h6,9H,1-5,8H2,(H,10,11)/t6-/m1/s1
InChIKeyAIVJJOBGQHTQOE-ZCFIWIBFSA-N
MW161.20 g/mol
LogP-0.05
Rot. Bonds6

About (2R)-7-amino-2-hydroxyheptanoic acid

(2R)-7-amino-2-hydroxyheptanoic acid (PubChem CID 144842569) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is (2R)-7-amino-2-hydroxyheptanoic acid.

Molecular Properties

Compound Name(2R)-7-amino-2-hydroxyheptanoic acid
PubChem CID144842569
Molecular FormulaC7H15NO3
Molecular Weight161.20 g/mol
Exact Mass161.11
IUPAC Name(2R)-7-amino-2-hydroxyheptanoic acid
SMILESNCCCCC[C@@H](O)C(=O)O
InChIInChI=1S/C7H15NO3/c8-5-3-1-2-4-6(9)7(10)11/h6,9H,1-5,8H2,(H,10,11)/t6-/m1/s1
InChIKeyAIVJJOBGQHTQOE-ZCFIWIBFSA-N
XLogP-0.05
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.20
LogP ≤ 5-0.05
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2R)-7-amino-2-hydroxyheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

6-amino-2-hydroxyhexanoic acid
CID 517029
2-(11-aminoundecyl)propanedioic acid
CID 87187189
2-(7-aminoheptyl)propanedioic acid
CID 90276909
2,10-dihydroxydecanoic acid
CID 23158566
2-hydroxynonanedioic acid
CID 12760708
2,13-diaminotridecanoic acid
CID 141414897
2-hydroxydecanoic acid
CID 161255514
2-hydroxy-17-methyloctadecanoic acid
CID 23427391
(2S)-2,6-diaminohexanoic acid;pentane-1,5-diamine
CID 87328180
(2R)-2-hydroxydecanoic acid
CID 13144006
2-hydroxytridecanoic acid
CID 5282901
2-hydroxyoctadecanoic acid
CID 87724091

Frequently Asked Questions

What is the IUPAC name of (2R)-7-amino-2-hydroxyheptanoic acid?
The IUPAC name of (2R)-7-amino-2-hydroxyheptanoic acid (CID 144842569) is (2R)-7-amino-2-hydroxyheptanoic acid.
What is the SMILES notation for (2R)-7-amino-2-hydroxyheptanoic acid?
The canonical SMILES for (2R)-7-amino-2-hydroxyheptanoic acid is NCCCCC[C@@H](O)C(=O)O.
What is the InChIKey of (2R)-7-amino-2-hydroxyheptanoic acid?
The InChIKey is AIVJJOBGQHTQOE-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H15NO3/c8-5-3-1-2-4-6(9)7(10)11/h6,9H,1-5,8H2,(H,10,11)/t6-/m1/s1.
What are the key properties of (2R)-7-amino-2-hydroxyheptanoic acid?
(2R)-7-amino-2-hydroxyheptanoic acid has a molecular weight of 161.20 g/mol, XLogP of -0.05, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-7-amino-2-hydroxyheptanoic acid is sourced from PubChem (CID 144842569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).