(2R)-2-hydroxydecanoic acid

C10H20O3 — CID 13144006

IUPAC(2R)-2-hydroxydecanoic acid
SMILESCCCCCCCC[C@@H](O)C(=O)O
InChIInChI=1S/C10H20O3/c1-2-3-4-5-6-7-8-9(11)10(12)13/h9,11H,2-8H2,1H3,(H,12,13)/t9-/m1/s1
InChIKeyGHPVDCPCKSNJDR-SECBINFHSA-N
MW188.27 g/mol
LogP2.18
Rot. Bonds8

About (2R)-2-hydroxydecanoic acid

(2R)-2-hydroxydecanoic acid (PubChem CID 13144006) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2R)-2-hydroxydecanoic acid.

Molecular Properties

Compound Name(2R)-2-hydroxydecanoic acid
PubChem CID13144006
Molecular FormulaC10H20O3
Molecular Weight188.27 g/mol
Exact Mass188.14
IUPAC Name(2R)-2-hydroxydecanoic acid
SMILESCCCCCCCC[C@@H](O)C(=O)O
InChIInChI=1S/C10H20O3/c1-2-3-4-5-6-7-8-9(11)10(12)13/h9,11H,2-8H2,1H3,(H,12,13)/t9-/m1/s1
InChIKeyGHPVDCPCKSNJDR-SECBINFHSA-N
XLogP2.18
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.27
LogP ≤ 52.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2R)-2-hydroxydecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-hydroxydecanoic acid?
The IUPAC name of (2R)-2-hydroxydecanoic acid (CID 13144006) is (2R)-2-hydroxydecanoic acid.
What is the SMILES notation for (2R)-2-hydroxydecanoic acid?
The canonical SMILES for (2R)-2-hydroxydecanoic acid is CCCCCCCC[C@@H](O)C(=O)O.
What is the InChIKey of (2R)-2-hydroxydecanoic acid?
The InChIKey is GHPVDCPCKSNJDR-SECBINFHSA-N. The full InChI is InChI=1S/C10H20O3/c1-2-3-4-5-6-7-8-9(11)10(12)13/h9,11H,2-8H2,1H3,(H,12,13)/t9-/m1/s1.
What are the key properties of (2R)-2-hydroxydecanoic acid?
(2R)-2-hydroxydecanoic acid has a molecular weight of 188.27 g/mol, XLogP of 2.18, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxydecanoic acid is sourced from PubChem (CID 13144006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).