C36H72O5 — CID 87989363
2-hydroxyoctadecanoic acid;octadecanoic acid (PubChem CID 87989363) has the molecular formula C36H72O5 and a molecular weight of 584.97 g/mol. Its IUPAC name is 2-hydroxyoctadecanoic acid;octadecanoic acid.
| Compound Name | 2-hydroxyoctadecanoic acid;octadecanoic acid |
|---|---|
| PubChem CID | 87989363 |
| Molecular Formula | C36H72O5 |
| Molecular Weight | 584.97 g/mol |
| Exact Mass | 584.54 |
| IUPAC Name | 2-hydroxyoctadecanoic acid;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCC(O)C(=O)O.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O3.C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h17,19H,2-16H2,1H3,(H,20,21);2-17H2,1H3,(H,19,20) |
| InChIKey | LNYWXOWOHLSLBB-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.97 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|