About 2-hydroxytetradecanoic acid;titanium
2-hydroxytetradecanoic acid;titanium (PubChem CID 174290276) has the molecular formula C14H28O3Ti
and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-hydroxytetradecanoic acid;titanium.
Molecular Properties
| Compound Name | 2-hydroxytetradecanoic acid;titanium |
| PubChem CID | 174290276 |
| Molecular Formula | C14H28O3Ti |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-hydroxytetradecanoic acid;titanium |
| SMILES | CCCCCCCCCCCCC(O)C(=O)O.[Ti] |
| InChI | InChI=1S/C14H28O3.Ti/c1-2-3-4-5-6-7-8-9-10-11-12-13(15)14(16)17;/h13,15H,2-12H2,1H3,(H,16,17); |
| InChIKey | YJDCHZFZUHSKLS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxytetradecanoic acid;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxytetradecanoic acid;titanium?
The IUPAC name of 2-hydroxytetradecanoic acid;titanium (CID 174290276) is 2-hydroxytetradecanoic acid;titanium.
What is the SMILES notation for 2-hydroxytetradecanoic acid;titanium?
The canonical SMILES for 2-hydroxytetradecanoic acid;titanium is CCCCCCCCCCCCC(O)C(=O)O.[Ti].
What is the InChIKey of 2-hydroxytetradecanoic acid;titanium?
The InChIKey is YJDCHZFZUHSKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3.Ti/c1-2-3-4-5-6-7-8-9-10-11-12-13(15)14(16)17;/h13,15H,2-12H2,1H3,(H,16,17);.
What are the key properties of 2-hydroxytetradecanoic acid;titanium?
2-hydroxytetradecanoic acid;titanium has a molecular weight of 292.24 g/mol, XLogP of 3.74, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxytetradecanoic acid;titanium is sourced from PubChem (CID 174290276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).