About sodium;hydride;2-hydroxynonanoic acid
sodium;hydride;2-hydroxynonanoic acid (PubChem CID 175073840) has the molecular formula C9H19NaO3
and a molecular weight of 198.24 g/mol. Its IUPAC name is sodium;hydride;2-hydroxynonanoic acid.
Molecular Properties
| Compound Name | sodium;hydride;2-hydroxynonanoic acid |
| PubChem CID | 175073840 |
| Molecular Formula | C9H19NaO3 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | sodium;hydride;2-hydroxynonanoic acid |
| SMILES | CCCCCCCC(O)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C9H18O3.Na.H/c1-2-3-4-5-6-7-8(10)9(11)12;;/h8,10H,2-7H2,1H3,(H,11,12);;/q;+1;-1 |
| InChIKey | PAEZOHFKYPGIBP-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-hydroxynonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-hydroxynonanoic acid?
The IUPAC name of sodium;hydride;2-hydroxynonanoic acid (CID 175073840) is sodium;hydride;2-hydroxynonanoic acid.
What is the SMILES notation for sodium;hydride;2-hydroxynonanoic acid?
The canonical SMILES for sodium;hydride;2-hydroxynonanoic acid is CCCCCCCC(O)C(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-hydroxynonanoic acid?
The InChIKey is PAEZOHFKYPGIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3.Na.H/c1-2-3-4-5-6-7-8(10)9(11)12;;/h8,10H,2-7H2,1H3,(H,11,12);;/q;+1;-1.
What are the key properties of sodium;hydride;2-hydroxynonanoic acid?
sodium;hydride;2-hydroxynonanoic acid has a molecular weight of 198.24 g/mol, XLogP of -1.09, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-hydroxynonanoic acid is sourced from PubChem (CID 175073840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).