About 2-hydroxydecanoic acid
2-hydroxydecanoic acid (PubChem CID 161255514) has the molecular formula C20H40O6
and a molecular weight of 376.53 g/mol. Its IUPAC name is 2-hydroxydecanoic acid.
Molecular Properties
| Compound Name | 2-hydroxydecanoic acid |
| PubChem CID | 161255514 |
| Molecular Formula | C20H40O6 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 2-hydroxydecanoic acid |
| SMILES | CCCCCCCCC(O)C(=O)O.CCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/2C10H20O3/c2*1-2-3-4-5-6-7-8-9(11)10(12)13/h2*9,11H,2-8H2,1H3,(H,12,13) |
| InChIKey | VBVXXHOQTDZJQS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxydecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxydecanoic acid?
The IUPAC name of 2-hydroxydecanoic acid (CID 161255514) is 2-hydroxydecanoic acid.
What is the SMILES notation for 2-hydroxydecanoic acid?
The canonical SMILES for 2-hydroxydecanoic acid is CCCCCCCCC(O)C(=O)O.CCCCCCCCC(O)C(=O)O.
What is the InChIKey of 2-hydroxydecanoic acid?
The InChIKey is VBVXXHOQTDZJQS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H20O3/c2*1-2-3-4-5-6-7-8-9(11)10(12)13/h2*9,11H,2-8H2,1H3,(H,12,13).
What are the key properties of 2-hydroxydecanoic acid?
2-hydroxydecanoic acid has a molecular weight of 376.53 g/mol, XLogP of 4.36, 16 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxydecanoic acid is sourced from PubChem (CID 161255514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).