C23H28O3 — CID 10618001
(E)-1-(3,4-dimethoxyphenyl)-9-phenylnon-2-en-1-one (PubChem CID 10618001) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-9-phenylnon-2-en-1-one.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-9-phenylnon-2-en-1-one |
|---|---|
| PubChem CID | 10618001 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-9-phenylnon-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/CCCCCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C23H28O3/c1-25-22-17-16-20(18-23(22)26-2)21(24)15-11-6-4-3-5-8-12-19-13-9-7-10-14-19/h7,9-11,13-18H,3-6,8,12H2,1-2H3/b15-11+ |
| InChIKey | JTEZHNAURQYHSU-RVDMUPIBSA-N |
| XLogP | 5.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|