C17H24O3 — CID 10356098
ethyl (Z)-7-(4-hydroxy-3,5-dimethylphenyl)hept-2-enoate (PubChem CID 10356098) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl (Z)-7-(4-hydroxy-3,5-dimethylphenyl)hept-2-enoate.
| Compound Name | ethyl (Z)-7-(4-hydroxy-3,5-dimethylphenyl)hept-2-enoate |
|---|---|
| PubChem CID | 10356098 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | ethyl (Z)-7-(4-hydroxy-3,5-dimethylphenyl)hept-2-enoate |
| SMILES | CCOC(=O)/C=C\CCCCc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C17H24O3/c1-4-20-16(18)10-8-6-5-7-9-15-11-13(2)17(19)14(3)12-15/h8,10-12,19H,4-7,9H2,1-3H3/b10-8- |
| InChIKey | GDBCBGHGFFXUIR-NTMALXAHSA-N |
| XLogP | 3.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|