C13H18O2 — CID 10058811
5-(4-hydroxy-3,5-dimethylphenyl)pentanal (PubChem CID 10058811) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 5-(4-hydroxy-3,5-dimethylphenyl)pentanal.
| Compound Name | 5-(4-hydroxy-3,5-dimethylphenyl)pentanal |
|---|---|
| PubChem CID | 10058811 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 5-(4-hydroxy-3,5-dimethylphenyl)pentanal |
| SMILES | Cc1cc(CCCCC=O)cc(C)c1O |
| InChI | InChI=1S/C13H18O2/c1-10-8-12(6-4-3-5-7-14)9-11(2)13(10)15/h7-9,15H,3-6H2,1-2H3 |
| InChIKey | SIRAZLWETGKVOU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|