C22H30O2 — CID 174910624
4-[6-(4-hydroxy-3,5-dimethylphenyl)hexyl]-2,6-dimethylphenol (PubChem CID 174910624) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 4-[6-(4-hydroxy-3,5-dimethylphenyl)hexyl]-2,6-dimethylphenol.
| Compound Name | 4-[6-(4-hydroxy-3,5-dimethylphenyl)hexyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 174910624 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 4-[6-(4-hydroxy-3,5-dimethylphenyl)hexyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(CCCCCCc2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C22H30O2/c1-15-11-19(12-16(2)21(15)23)9-7-5-6-8-10-20-13-17(3)22(24)18(4)14-20/h11-14,23-24H,5-10H2,1-4H3 |
| InChIKey | IYTCNPZJXMMXIE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|